| Melting point |
118-121 °C (lit.) |
| vapor density |
14.9 (vs air) |
| storage temp. |
Inert atmosphere,Room Temperature |
| solubility |
Practically insoluble in water and in ethanol (96 per cent). |
| form |
Solid |
| color |
White to Off-White |
| Specific Gravity |
1.1 |
| Hydrolytic Sensitivity |
4: no reaction with water under neutral conditions |
| Merck |
13,9916 |
| Stability |
Hygroscopic |
| InChI |
InChI=1S/2C11H20O2.Zn/c2*1-2-3-4-5-6-7-8-9-10-11(12)13;/h2*2H,1,3-10H2,(H,12,13);/q;;+2/p-2 |
| InChIKey |
YMCOHQVWOBMDCZ-UHFFFAOYSA-L |
| SMILES |
O([Zn]OC(=O)CCCCCCCCC=C)C(=O)CCCCCCCCC=C |
| LogP |
3.987 (est) |
| CAS DataBase Reference |
557-08-4(CAS DataBase Reference) |
| EPA Substance Registry System |
10-Undecenoic acid, zinc salt (557-08-4) |
