2-Mercapto-5-methylbenzimidazole
- Product Name2-Mercapto-5-methylbenzimidazole
- CAS27231-36-3
- MFC8H8N2S
- MW164.23
- EINECS248-350-5
- MOL File27231-36-3.mol
Chemical Properties
| Melting point | 290-293 °C(lit.) |
| Boiling point | 282.5±33.0 °C(Predicted) |
| Density | 1.1724 (rough estimate) |
| refractive index | 1.5700 (estimate) |
| storage temp. | Store at room temperature |
| pka | 10.60±0.30(Predicted) |
| form | powder to crystal |
| color | White to Light yellow |
| Water Solubility | Insoluble in water. |
| BRN | 5083 |
| InChI | InChI=1S/C8H8N2S/c1-5-2-3-6-7(4-5)10-8(11)9-6/h2-4H,1H3,(H2,9,10,11) |
| InChIKey | CWIYBOJLSWJGKV-UHFFFAOYSA-N |
| SMILES | C1(=S)NC2=CC=C(C)C=C2N1 |
| CAS DataBase Reference | 27231-36-3(CAS DataBase Reference) |
| EPA Substance Registry System | 2H-Benzimidazole-2-thione, 1,3-dihydro-5-methyl- (27231-36-3) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 2933998090 |
