Crotonic anhydride
- Product NameCrotonic anhydride
- CAS623-68-7
- MFC8H10O3
- MW154.17
- EINECS210-807-1
- MOL File623-68-7.mol
Chemical Properties
| Melting point | -20°C |
| Boiling point | 248 °C(lit.) |
| Density | 1.04 g/mL at 25 °C(lit.) |
| vapor pressure | 1 hPa (25 °C) |
| refractive index | n |
| Flash point | 231 °F |
| storage temp. | Store below +30°C. |
| solubility | soluble in Ether |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| InChI | 1S/C8H10O3/c1-3-5-7(9)11-8(10)6-4-2/h3-6H,1-2H3/b5-3+,6-4+ |
| InChIKey | VJDDQSBNUHLBTD-GGWOSOGESA-N |
| SMILES | O(C(=O)\C=C\C)C(=O)\C=C\C |
| CAS DataBase Reference | 623-68-7(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Butenoic acid, anhydride (623-68-7) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 3 |
| WGK Germany | 3 |
| RTECS | GQ6125000 |
| Autoignition Temperature | 290 °C |
| TSCA | TSCA listed |
| HS Code | 2916 19 95 |
| HazardClass | 8 |
| PackingGroup | III |
| Storage Class | 8A - Combustible, corrosive hazardous materials |
| Hazard Classifications | Aquatic Acute 1 Eye Dam. 1 Skin Corr. 1B |
| Hazardous Substances Data | 623-68-7(Hazardous Substances Data) |
| Toxicity | LD50 orally in Rabbit: 2061 mg/kg |