3,5-Di-tert-butylbromobenzene
- Product Name3,5-Di-tert-butylbromobenzene
- CAS22385-77-9
- MFC14H21Br
- MW269.22
- EINECS607-060-2
- MOL File22385-77-9.mol
Chemical Properties
| Melting point | 62-66 °C(lit.) |
| Boiling point | 152-156 °C(Press: 26 Torr) |
| Density | 1.126±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | 35μg/L at 25℃ |
| BRN | 2091559 |
| InChI | InChI=1S/C14H21Br/c1-13(2,3)10-7-11(14(4,5)6)9-12(15)8-10/h7-9H,1-6H3 |
| InChIKey | BUOWTUULDKULFI-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC(C(C)(C)C)=CC(C(C)(C)C)=C1 |
| LogP | 6.7 at 25℃ |
| CAS DataBase Reference | 22385-77-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29039990 |
