5-Azaindole
- Product Name5-Azaindole
- CAS271-34-1
- MFC7H6N2
- MW118.14
- EINECS676-348-8
- MOL File271-34-1.mol
Chemical Properties
| Melting point | 104.6-108.4°C |
| Boiling point | 132°C/0.2mmHg(lit.) |
| Density | 1.242±0.06 g/cm3(Predicted) |
| RTECS | UY8725000 |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to crystal |
| pka | 15.20±0.30(Predicted) |
| color | White to Light yellow |
| Water Solubility | Hardly soluble in water. Soluble in methanol and chloroform. |
| λmax | 264nm(H2O)(lit.) |
| InChI | InChI=1S/C7H6N2/c1-4-9-7-2-3-8-5-6(1)7/h1-5,9H |
| InChIKey | SRSKXJVMVSSSHB-UHFFFAOYSA-N |
| SMILES | C1=NC=CC2NC=CC1=2 |
| CAS DataBase Reference | 271-34-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-41-37/38-22 |
| Safety Statements | 26-36/37/39-39 |
| Hazard Note | Irritant |
| HS Code | 29339980 |
