Monoperoxyphthalic acid magnesium salt hexahydrate
- Product NameMonoperoxyphthalic acid magnesium salt hexahydrate
- CAS84665-66-7
- MFC16H11MgO11-
- MW403.56
- EINECS617-608-2
- MOL File84665-66-7.mol
Chemical Properties
| Melting point | 93 °C (dec.)(lit.) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO, Methanol |
| form | Solid |
| color | White to Off-White |
| InChI | InChI=1S/2C8H6O5.Mg.H2O/c2*9-7(10)5-3-1-2-4-6(5)8(11)13-12;;/h2*1-4,12H,(H,9,10);;1H2/q;;+2;/p-3 |
| InChIKey | WWOYCMCZTZTIGU-UHFFFAOYSA-L |
| SMILES | C(C1C=CC=CC=1C1O[O-][Mg+2]2([O-]OC(C3C=CC=CC=3C(=O)[O-])=O2)O=1)(=O)[O-].[H+].O |
| CAS DataBase Reference | 84665-66-7(CAS DataBase Reference) |
Safety Information
| Hazard Codes | O,Xi |
| Risk Statements | 8-36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HS Code | 29173990 |
| Storage Class | 5.2 - Organic peroxides and self-reacting hazardous materials |
| Hazard Classifications | Acute Tox. 4 Inhalation Eye Dam. 1 Org. Perox. E Skin Corr. 1C |
