3,5-Dibromobenzoic acid
- Product Name3,5-Dibromobenzoic acid
- CAS618-58-6
- MFC7H4Br2O2
- MW279.91
- EINECS
- MOL File618-58-6.mol
Chemical Properties
| Melting point | 218-220 °C (lit.) |
| Boiling point | 355.2±32.0 °C(Predicted) |
| Density | 1.9661 (rough estimate) |
| refractive index | 1.4970 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Very faint turbidity in methanol. |
| form | powder to crystal |
| pka | 3.42±0.10(Predicted) |
| color | White to Light yellow |
| BRN | 1940691 |
| InChI | InChI=1S/C7H4Br2O2/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3H,(H,10,11) |
| InChIKey | SFTFNJZWZHASAQ-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(Br)=CC(Br)=C1 |
| CAS DataBase Reference | 618-58-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,5-Dibromobenzoic acid(618-58-6) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| RTECS | DG6290010 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |