2,5-DIBROMO-3-METHYLTHIOPHENE
- Product Name2,5-DIBROMO-3-METHYLTHIOPHENE
- CAS13191-36-1
- MFC5H4Br2S
- MW255.96
- EINECS236-147-4
- MOL File13191-36-1.mol
Chemical Properties
| Melting point | 130-132 °C |
| Boiling point | 226-230°C |
| Density | 1.974 g/mL at 25 °C |
| refractive index | 1.6130 |
| Flash point | 226-230°C |
| storage temp. | 2-8°C |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| Sensitive | Light Sensitive |
| BRN | 108894 |
| InChI | InChI=1S/C5H4Br2S/c1-3-2-4(6)8-5(3)7/h2H,1H3 |
| InChIKey | IHFXZROPBCBLLG-UHFFFAOYSA-N |
| SMILES | C1(Br)SC(Br)=CC=1C |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 36/38-41-38-22 |
| Safety Statements | 26-36/37/39-39 |
| RIDADR | UN 2810 6.1 / PGIII |
| WGK Germany | 3 |
| HS Code | 2930.90.2900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 |