3-Nitrostyrene
- Product Name3-Nitrostyrene
- CAS586-39-0
- MFC8H7NO2
- MW149.15
- EINECS209-575-4
- MOL File586-39-0.mol
Chemical Properties
| Melting point | -5 °C (lit.) |
| Boiling point | 81-83°C 1mm |
| Density | 1.07 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 225 °F |
| storage temp. | 2-8°C |
| form | Powder or Needles |
| color | White to off-white |
| BRN | 2042423 |
| Stability | Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI | 1S/C8H7NO2/c1-2-7-4-3-5-8(6-7)9(10)11/h2-6H,1H2 |
| InChIKey | SYZVQXIUVGKCBJ-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1cccc(C=C)c1 |
| CAS DataBase Reference | 586-39-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Nitrostyrene(586-39-0) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-24/25 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29042090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |