1-(4-Nitrophenyl)piperazine
- Product Name1-(4-Nitrophenyl)piperazine
- CAS6269-89-2
- MFC10H13N3O2
- MW207.23
- EINECS228-443-7
- MOL File6269-89-2.mol
Chemical Properties
| Melting point | 131-133 °C (lit.) |
| Boiling point | 346.25°C (rough estimate) |
| Density | 1.1933 (rough estimate) |
| refractive index | 1.4830 (estimate) |
| storage temp. | Storage temp. 2-8°C |
| form | Crystalline Powder, Crystals and/or Chunks |
| pka | 8.68±0.10(Predicted) |
| color | White to beige to gray |
| InChI | InChI=1S/C10H13N3O2/c14-13(15)10-3-1-9(2-4-10)12-7-5-11-6-8-12/h1-4,11H,5-8H2 |
| InChIKey | VWOJSRICSKDKAW-UHFFFAOYSA-N |
| SMILES | N1(C2=CC=C([N+]([O-])=O)C=C2)CCNCC1 |
| CAS DataBase Reference | 6269-89-2(CAS DataBase Reference) |
| NIST Chemistry Reference | N-p-nitrophenylpiperazine(6269-89-2) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-37/39-24/25-36 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29335990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |