4-Chloro-3-methylbenzoic acid
- Product Name4-Chloro-3-methylbenzoic acid
- CAS7697-29-2
- MFC8H7ClO2
- MW170.59
- EINECS618-347-7
- MOL File7697-29-2.mol
Chemical Properties
| Melting point | 216 °C |
| Boiling point | 299.0±20.0 °C(Predicted) |
| Density | 1.310±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 4.04±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| BRN | 1936535 |
| InChI | InChI=1S/C8H7ClO2/c1-5-4-6(8(10)11)2-3-7(5)9/h2-4H,1H3,(H,10,11) |
| InChIKey | MRUKIIWRMSYKML-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(Cl)C(C)=C1 |
| CAS DataBase Reference | 7697-29-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-37/38-36 |
| Safety Statements | 26-36/37/39-36 |
| HazardClass | IRRITANT |
| HS Code | 2916399090 |
