(-)-ISOLEDENE
- Product Name(-)-ISOLEDENE
- CAS95910-36-4
- MFC15H24
- MW204.35
- EINECS
- MOL File95910-36-4.mol
Chemical Properties
| Boiling point | 95 °C/5 mmHg (lit.) |
| Density | 0.902 g/mL at 20 °C (lit.) |
| refractive index | n |
| storage temp. | 2-8°C |
| optical activity | [α]20/D 50.5±1°, neat |
| BRN | 2085196 |
| Major Application | cleaning products cosmetics flavors and fragrances food and beverages personal care |
| InChI | 1S/C15H24/c1-9-6-8-12-14(15(12,3)4)13-10(2)5-7-11(9)13/h9-10,12,14H,5-8H2,1-4H3/t9-,10-,12-,14-/m1/s1 |
| InChIKey | NUQDPKOFUKFKFD-BGOOENEXSA-N |
| SMILES | C[C@@H]1CC[C@@H]2[C@H](C3=C1CC[C@H]3C)C2(C)C |
| LogP | 6.385 (est) |
Safety Information
| Safety Statements | 23-24/25 |
| WGK Germany | 3 |
| F | 10-23 |
| Storage Class | 10 - Combustible liquids |