2,2,3,3,4,4-Hexafluoro-1,5-pentanediol
- Product Name2,2,3,3,4,4-Hexafluoro-1,5-pentanediol
- CAS376-90-9
- MFC5H6F6O2
- MW212.09
- EINECS206-819-1
- MOL File376-90-9.mol
Chemical Properties
| Melting point | 78-81 °C(lit.) |
| Boiling point | 111.5 °C10 mm Hg(lit.) |
| Density | 1.4048 (estimate) |
| Flash point | >110°C |
| form | powder to crystal |
| pka | 12.68±0.10(Predicted) |
| color | White to Almost white |
| BRN | 1766258 |
| InChI | 1S/C5H6F6O2/c6-3(7,1-12)5(10,11)4(8,9)2-13/h12-13H,1-2H2 |
| InChIKey | IELVMUPSWDZWSD-UHFFFAOYSA-N |
| SMILES | OCC(F)(F)C(F)(F)C(F)(F)CO |
| CAS DataBase Reference | 376-90-9(CAS DataBase Reference) |
| EPA Substance Registry System | 1,5-Pentanediol, 2,2,3,3,4,4-hexafluoro- (376-90-9) |
Safety Information
| Hazard Codes | Xn,Xi,T |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 36-36/37-26 |
| WGK Germany | 3 |
| RTECS | SA0750000 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HazardClass | IRRITANT, TOXIC |
| HS Code | 29055900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |