Bis-(1-octyloxy-2,2,6,6-tetramethyl-4-piperidinyl) sebacate
- Product NameBis-(1-octyloxy-2,2,6,6-tetramethyl-4-piperidinyl) sebacate
- CAS129757-67-1
- MFC40H80N2O6
- MW685.09
- EINECS406-750-9
- MOL File129757-67-1.mol
Chemical Properties
| Density | 1.028 g/mL at 25 °C(lit.) |
| vapor pressure | 0-0Pa at 20-25℃ |
| refractive index | n |
| Flash point | >230 °F |
| solubility | H2O: <6 ppm at 20 °C |
| Water Solubility | 6mg/L at 20℃ |
| InChIKey | OSIVCXJNIBEGCL-UHFFFAOYSA-N |
| SMILES | C(C)(C)(C)OO.C(CCC)CCCC.O(C1CC(C)(C)NC(C)(C)C1)C(=O)CCCCCCCCC(=O)OC1CC(C)(C)NC(C)(C)C1 |
| LogP | 16.8 at 20℃ |
| CAS DataBase Reference | 129757-67-1(CAS DataBase Reference) |
| EPA Substance Registry System | Decanedioic acid, bis(2,2,6,6-tetramethyl-4-piperidinyl) ester, reaction products with tert-Bu hydroperoxide and octane (129757-67-1) |
Safety Information
| Safety Statements | 23-24/25 |
| WGK Germany | 1 |
| TSCA | TSCA listed |
| Storage Class | 10 - Combustible liquids |
