| Melting point |
116-118 °C(lit.) |
| Boiling point |
322.5±30.0 °C(Predicted) |
| Density |
1.262±0.06 g/cm3(Predicted) |
| storage temp. |
2-8°C |
| solubility |
methanol: 0.1 g/mL, clear |
| form |
Solid |
| pka |
pKa 3.38(H2O
t = 25
c = 0.03–0.001) (Uncertain) |
| color |
White to Off-White |
| Water Solubility |
Soluble in water (20 g/L) at 20°C, ethanol, ether, alcohol, and methanol (0.1 g/ml). |
| Merck |
14,9779 |
| BRN |
2209199 |
| Stability |
Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI |
InChI=1S/C9H10O3/c10-6-8(9(11)12)7-4-2-1-3-5-7/h1-5,8,10H,6H2,(H,11,12) |
| InChIKey |
JACRWUWPXAESPB-UHFFFAOYSA-N |
| SMILES |
C(C1C=CC=CC=1)(CO)C(=O)O |
| LogP |
0.280 (est) |
| EPA Substance Registry System |
Tropic acid (552-63-6) |
