2,6-Bis(2-benzimidazolyl)pyridine
- Product Name2,6-Bis(2-benzimidazolyl)pyridine
- CAS28020-73-7
- MFC19H13N5
- MW311.34
- EINECS624-875-9
- MOL File28020-73-7.mol
Chemical Properties
| Melting point | >300 °C(lit.) |
| Boiling point | 664.0±65.0 °C(Predicted) |
| Density | 1.386±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 10.36±0.10(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| λmax | 325nm(CH3CN)(lit.) |
| InChI | InChI=1S/C19H13N5/c1-2-7-13-12(6-1)21-18(22-13)16-10-5-11-17(20-16)19-23-14-8-3-4-9-15(14)24-19/h1-11H,(H,21,22)(H,23,24) |
| InChIKey | JBKICBDXAZNSKA-UHFFFAOYSA-N |
| SMILES | C1(C2NC3=CC=CC=C3N=2)=NC(C2NC3=CC=CC=C3N=2)=CC=C1 |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |