Diphenylgermanium dichloride
- Product NameDiphenylgermanium dichloride
- CAS1613-66-7
- MFC12H10Cl2Ge
- MW297.75
- EINECS216-562-7
- MOL File1613-66-7.mol
Chemical Properties
| Melting point | 9°C |
| Boiling point | 100 °C/0.005 mmHg (lit.) |
| Density | 1.415 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | >230 °F |
| form | Liquid |
| Specific Gravity | 1.415 |
| color | Colorless to Almost colorless |
| Water Solubility | Insoluble in water. |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C12H10Cl2Ge/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
| InChIKey | PFPTYRFVUHDUIN-UHFFFAOYSA-N |
| SMILES | [Ge](Cl)(Cl)(C1=CC=CC=C1)C1=CC=CC=C1 |
| CAS DataBase Reference | 1613-66-7(CAS DataBase Reference) |
| EPA Substance Registry System | Germane, dichlorodiphenyl- (1613-66-7) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2931.90.6000 |
| HazardClass | 8 |
| PackingGroup | II |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |