Chemical Properties
| Melting point | 88-90℃ |
| Boiling point | 476.6±45.0 °C(Predicted) |
| Density | 1.25±0.1 g/cm3(Predicted) |
| storage temp. | −20°C |
| solubility | DMF:5.0(Max Conc. mg/mL);0.64(Max Conc. mM) DMSO:18.17(Max Conc. mg/mL);57.77(Max Conc. mM) Ethanol:5.0(Max Conc. mg/mL);0.64(Max Conc. mM) Ethanol:PBS (pH 7.2) (1:5):0.02(Max Conc. mg/mL);0.06(Max Conc. mM) |
| pka | 14.43±0.40(Predicted) |
| form | White to off-white solid. |
| color | Off-white to light yellow |
| Major Application | food and beverages |
| InChI | 1S/C20H26O3/c1-18-7-5-16-14(6-9-23-16)15(18)4-8-19-10-13(2-3-17(18)19)20(22,11-19)12-21/h5-7,9,13,15,17,21-22H,2-4,8,10-12H2,1H3/t13-,15-,17+,18-,19+,20+/m1/s1 |
| InChIKey | JEKMKNDURXDJAD-HWUKTEKMSA-N |
| SMILES | CC12C=Cc3occc3C1CCC45CC(CCC24)C(O)(CO)C5 |
| LogP | 3.380 (est) |