Melting point |
63-64°C |
Boiling point |
315°C |
Density |
1.23 |
vapor pressure |
0.005-0.01Pa at 20-25℃ |
Flash point |
136°C |
storage temp. |
Sealed in dry,2-8°C |
solubility |
Soluble in ethanol |
form |
Powder |
color |
Yellow to Brown |
InChI |
InChI=1/C11H16O7/c1-5-9(16-6(2)12)10(17-7(3)13)11(15-5)18-8(4)14/h5,9-11H,1-4H3/t5-,9-,10-,11+/s3 |
InChIKey |
NXEJETQVUQAKTO-QPGVQJSANA-N |
SMILES |
O([C@H]1[C@@H](O[C@H](C)[C@H]1OC(=O)C)OC(=O)C)C(=O)C |&1:1,2,4,6,r| |
LogP |
0.377-0.43 at 25℃ |
Surface tension |
39.28mN/m at 1.01g/L and 20℃ |
CAS DataBase Reference |
62211-93-2(CAS DataBase Reference) |