2,7-Dibromonaphthalene
- Product Name2,7-Dibromonaphthalene
- CAS58556-75-5
- MFC10H6Br2
- MW285.96
- EINECS626-418-9
- MOL File58556-75-5.mol
Chemical Properties
| Melting point | 139-142 °C |
| Boiling point | 339.1±15.0 °C(Predicted) |
| Density | 1.834±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Soluble in acetonitrile. |
| form | powder to crystal |
| color | White to Light yellow |
| BRN | 1862041 |
| InChI | InChI=1S/C10H6Br2/c11-9-3-1-7-2-4-10(12)6-8(7)5-9/h1-6H |
| InChIKey | ODJZWBLNJKNOJK-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=CC(Br)=C2)=CC=C1Br |
| CAS DataBase Reference | 58556-75-5(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,N |
| Risk Statements | 36-51/53 |
| Safety Statements | 22-24/25-61-26 |
| RIDADR | UN3077 9/PG 3 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HazardClass | 9 |
| HS Code | 29039990 |
