Z-TLE-OH DCHA
- Product NameZ-TLE-OH DCHA
- CAS62965-37-1
- MFC14H19NO4.C12H23N
- MW446.63
- EINECS478-250-9
- MOL File62965-37-1.mol
Chemical Properties
| Melting point | 163-167 °C |
| Density | 1.1 at 20℃ |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | 2-8°C |
| form | Solid |
| PH | 6.3 (H2O, 20℃)(saturated solution) |
| Appearance | White to off-white Solid |
| optical activity | [α]20/D 6.5±1°, c = 1% in methanol |
| BRN | 3831936 |
| Major Application | peptide synthesis |
| InChIKey | ZZVHEFCADXTNTP-RFVHGSKJSA-N |
| SMILES | C1CCC(CC1)NC2CCCCC2.CC(C)(C)[C@H](NC(=O)OCc3ccccc3)C(O)=O |
| LogP | 1.6 at 25℃ and pH2.5 |
| Surface tension | 63mN/m at 1g/L and 20℃ |
Safety Information
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 2906190090 |
| Storage Class | 11 - Combustible Solids |
