Cloperastine hydrochloride
- Product NameCloperastine hydrochloride
- CAS14984-68-0
- MFC20H25Cl2NO
- MW366.32
- EINECS239-067-8
- MOL File14984-68-0.mol
Chemical Properties
| Melting point | 147.9° |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| Merck | 14,2395 |
| Major Application | forensics and toxicology pharmaceutical (small molecule) veterinary |
| InChI | InChI=1S/C20H24ClNO.ClH/c21-19-11-9-18(10-12-19)20(17-7-3-1-4-8-17)23-16-15-22-13-5-2-6-14-22;/h1,3-4,7-12,20H,2,5-6,13-16H2;1H |
| InChIKey | UNPLRYRWJLTVAE-UHFFFAOYSA-N |
| SMILES | C(OCCN1CCCCC1)(C1C=CC=CC=1)C1=CC=C(Cl)C=C1.Cl |
| CAS DataBase Reference | 14984-68-0(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 36 |
| WGK Germany | 3 |
| RTECS | TM6491500 |
| HS Code | 2933.39.9200 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |