| Melting point |
18°C |
| Boiling point |
256℃ |
| Density |
0.912 |
| vapor pressure |
0Pa at 25℃ |
| refractive index |
1.451 |
| Flash point |
210℃ |
| form |
powder to lump to clear liquid |
| color |
White or Colorless to Light yellow |
| Water Solubility |
3.856ng/L at 25℃ |
| FreezingPoint |
-48℃ |
| Dielectric constant |
4.0（27℃） |
| InChI |
InChI=1S/C26H50O4/c1-3-5-7-9-15-19-23-29-25(27)21-17-13-11-12-14-18-22-26(28)30-24-20-16-10-8-6-4-2/h3-24H2,1-2H3 |
| InChIKey |
MIMDHDXOBDPUQW-UHFFFAOYSA-N |
| SMILES |
C(OCCCCCCCC)(=O)CCCCCCCCC(OCCCCCCCC)=O |
| LogP |
10.23 at 25℃ |
| CAS DataBase Reference |
2432-87-3(CAS DataBase Reference) |
| EPA Substance Registry System |
Decanedioic acid, dioctyl ester (2432-87-3) |
