4-Chloro-3-nitrobenzaldehyde
- Product Name4-Chloro-3-nitrobenzaldehyde
- CAS16588-34-4
- MFC7H4ClNO3
- MW185.56
- EINECS240-645-7
- MOL File16588-34-4.mol
Chemical Properties
| Melting point | 61-63 °C (lit.) |
| Boiling point | 276.5°C (rough estimate) |
| Density | 1.4791 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | 4g/l |
| form | Powder |
| color | Off-white to light yellow to light green |
| Water Solubility | 4 g/L (98 ºC) |
| Sensitive | Air Sensitive |
| BRN | 778323 |
| InChI | 1S/C7H4ClNO3/c8-6-2-1-5(4-10)3-7(6)9(11)12/h1-4H |
| InChIKey | HETBKLHJEWXWBM-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1cc(C=O)ccc1Cl |
| CAS DataBase Reference | 16588-34-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Chloro-3-nitrobenzaldehyde(16588-34-4) |
| EPA Substance Registry System | Benzaldehyde, 4-chloro-3-nitro- (16588-34-4) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-43 |
| Safety Statements | 26-36/37-36/37/39-22-36 |
| WGK Germany | 3 |
| F | 10 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 29130000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |