3-Cyano-4,6-dimethyl-2-hydroxypyridine
- Product Name3-Cyano-4,6-dimethyl-2-hydroxypyridine
- CAS769-28-8
- MFC8H8N2O
- MW148.16
- EINECS212-207-5
- MOL File769-28-8.mol
Chemical Properties
| Melting point | 285-287 °C (lit.) |
| Boiling point | 268.75°C (rough estimate) |
| Density | 1.1828 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | 9.06±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| BRN | 130992 |
| InChI | InChI=1S/C8H8N2O/c1-5-3-6(2)10-8(11)7(5)4-9/h3H,1-2H3,(H,10,11) |
| InChIKey | OCYMJCILWYHKAU-UHFFFAOYSA-N |
| SMILES | C1(=O)NC(C)=CC(C)=C1C#N |
| CAS DataBase Reference | 769-28-8(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-37/39 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| RTECS | QT3046500 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
