Chemical Properties
| Boiling point | 163.7°C |
| Density | 0.842 g/mL at 25 °C |
| vapor pressure | 87hPa at 20℃ |
| refractive index | 1.4860 (estimate) |
| Flash point | 37℃ |
| storage temp. | 2-8°C |
| solubility | DMF: 20 mg/ml; DMSO: 20 mg/ml; Ethanol: 20 mg/ml; Ethanol:PBS (pH 7.2)(1:2): 0.33 mg/ml |
| form | A neat oil |
| color | Colorless to light yellow |
| Odor | at 10.00 % in dipropylene glycol. woody terpene citrus pine spice |
| Odor Type | woody |
| Water Solubility | 5.03mg/L at 20℃ |
| Henry's Law Constant | 1.5×10-4 mol/(m3Pa) at 25℃, Plyasunov and Shock (2000) |
| Major Application | food and beverages |
| InChI | InChI=1S/C10H16/c1-7(2)10-5-4-8(3)9(10)6-10/h7,9H,3-6H2,1-2H3 |
| InChIKey | NDVASEGYNIMXJL-UHFFFAOYSA-N |
| SMILES | C(C12CCC(C1C2)=C)(C)C |
| LogP | 5.5 at 25℃ |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 16-26-36/37/39 |
| RIDADR | 1993 |
| WGK Germany | 3 |
| HazardClass | 3.2 |
| PackingGroup | III |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Oral Flam. Liq. 3 |
