| Melting point |
187-193 °C(lit.) |
| Boiling point |
347.16°C (rough estimate) |
| Density |
1.2379 (rough estimate) |
| vapor pressure |
0Pa at 25℃ |
| refractive index |
1.5389 (estimate) |
| Flash point |
232°C |
| storage temp. |
Sealed in dry,Room Temperature |
| form |
powder to crystal |
| color |
White to Almost white |
| Water Solubility |
Soluble in hot toluene (very faint turbidity). Insoluble in water. |
| BRN |
987259 |
| InChI |
InChI=1S/C14H12O4/c1-17-13(15)11-5-3-10-8-12(14(16)18-2)6-4-9(10)7-11/h3-8H,1-2H3 |
| InChIKey |
GYUVMLBYMPKZAZ-UHFFFAOYSA-N |
| SMILES |
C1=C2C(C=C(C(OC)=O)C=C2)=CC=C1C(OC)=O |
| LogP |
3.5 at 25℃ |
| CAS DataBase Reference |
840-65-3(CAS DataBase Reference) |
| EPA Substance Registry System |
Dimethyl 2,6-naphthalenedicarboxylate (840-65-3) |
