Mecarbinate
- Product NameMecarbinate
- CAS15574-49-9
- MFC13H15NO3
- MW233.26
- EINECS605-026-1
- MOL File15574-49-9.mol
Chemical Properties
| Melting point | 210.0 to 214.0 °C |
| Boiling point | 399.8±37.0 °C(Predicted) |
| Density | 1.20±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | ≥ 7.1mg/mL in DMSO |
| form | powder to crystal |
| pka | 9.26±0.40(Predicted) |
| color | White to Orange to Green |
| InChI | InChI=1S/C13H15NO3/c1-4-17-13(16)12-8(2)14(3)11-6-5-9(15)7-10(11)12/h5-7,15H,4H2,1-3H3 |
| InChIKey | YTBNTDMBGXAOCG-UHFFFAOYSA-N |
| SMILES | N1(C)C2=C(C=C(O)C=C2)C(C(OCC)=O)=C1C |
| CAS DataBase Reference | 15574-49-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RTECS | NL6003600 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
| Toxicity | mouse,LD,intraperitoneal,> 10gm/kg (10000mg/kg),Toksikologicheskii Vestnik. Vol. (1), Pg. 29, 1994. |