9-Aminoacridine hydrochloride hydrate
- Product Name9-Aminoacridine hydrochloride hydrate
- CAS52417-22-8
- MFC13H13ClN2O
- MW248.71
- EINECS675-675-3
- MOL File52417-22-8.mol
Chemical Properties
| Melting point | 300 °C(lit.) |
| storage temp. | Store below +30°C. |
| solubility | 3.3g/l |
| form | powder to crystal |
| color | Light yellow to Yellow to Orange |
| Water Solubility | Soluble in water (3.3 g/L) at 20°C. |
| Sensitive | Hygroscopic |
| λmax | 400 nm 420 nm (2nd) |
| Merck | 14,407 |
| BRN | 3707637 |
| Stability | Stable. Incompatible with strong oxidizing agents, strong bases, acid anhydrides. |
| InChI | InChI=1S/C13H10N2.ClH.H2O/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13;;/h1-8H,(H2,14,15);1H;1H2 |
| InChIKey | OREJEGKBQBIJSJ-UHFFFAOYSA-N |
| SMILES | NC1=C2C=CC=CC2=NC2C=CC=CC1=2.Cl.O |
| CAS DataBase Reference | 52417-22-8(CAS DataBase Reference) |
| EPA Substance Registry System | 9-Aminoacridine hydrochloride monohydrate (52417-22-8) |
Safety Information
| Hazard Codes | T,Xn,F |
| Risk Statements | 68-23/24/25-40-20/21/22-15-10-25 |
| Safety Statements | 22-24/25-45-43-36/37/39-36-7/8 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | AR6850000 |
| TSCA | Yes |
| HS Code | 2933 99 80 |
| HazardClass | 6.1 |
| PackingGroup | III |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |