alpha-(1-Naphthylmethyl)-2-tetrahydrofuranpropionic acid diethylaminoethyl ester oxalate
- Product Namealpha-(1-Naphthylmethyl)-2-tetrahydrofuranpropionic acid diethylaminoethyl ester oxalate
- CAS3200-06-4
- MFC26H35NO7
- MW473.56
- EINECS221-703-0
- MOL File3200-06-4.mol
Chemical Properties
| Melting point | 110-111° |
| Boiling point | 574°C (rough estimate) |
| Density | 1.2205 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Store at -20°C |
| solubility | Freely soluble in water, freely soluble or soluble in ethanol (96 per cent), slightly or sparingly soluble in acetone. |
| form | Solid |
| color | White to off-white |
| Major Application | forensics and toxicology pharmaceutical (small molecule) |
| InChIKey | SSAJNPNVUYMUCI-UHFFFAOYSA-N |
| SMILES | OC(=O)C(O)=O.CCN(CC)CCOC(=O)C(CC1CCCO1)Cc2cccc3ccccc23 |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 22 |
| Safety Statements | 36 |
| WGK Germany | 3 |
| RTECS | LU5805000 |
| HS Code | 29321900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Oral |
| Toxicity | LD50 oral in rat: 711mg/kg |
