4-Methyl-3-nitrobenzonitrile
- Product Name4-Methyl-3-nitrobenzonitrile
- CAS939-79-7
- MFC8H6N2O2
- MW162.15
- EINECS
- MOL File939-79-7.mol
Chemical Properties
| Melting point | 102-106 °C (lit.) |
| Boiling point | 171°C 12mm |
| Density | 1.26±0.1 g/cm3(Predicted) |
| Flash point | 171°C/12mm |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Chloroform, Ethyl Acetate |
| form | Crystalline Powder |
| color | White to yellow to pale brown |
| BRN | 2047311 |
| InChI | 1S/C8H6N2O2/c1-6-2-3-7(5-9)4-8(6)10(11)12/h2-4H,1H3 |
| InChIKey | KOFBNBCOGKLUOM-UHFFFAOYSA-N |
| SMILES | Cc1ccc(cc1[N+]([O-])=O)C#N |
| CAS DataBase Reference | 939-79-7(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 3439 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
