1,1-Cyclohexanediacetic acid mono amide
- Product Name1,1-Cyclohexanediacetic acid mono amide
- CAS99189-60-3
- MFC10H17NO3
- MW199.25
- EINECS619-402-8
- MOL File99189-60-3.mol
Chemical Properties
| Melting point | 141-146 °C (lit.) |
| Boiling point | 443.6±18.0 °C(Predicted) |
| Density | 1.135±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 4.72±0.10(Predicted) |
| color | White to Off-White |
| biological source | human |
| InChI | InChI=1S/C10H17NO3/c11-8(12)6-10(7-9(13)14)4-2-1-3-5-10/h1-7H2,(H2,11,12)(H,13,14) |
| InChIKey | QJGSJXLCJRXTRY-UHFFFAOYSA-N |
| SMILES | C1(CC(N)=O)(CC(O)=O)CCCCC1 |
| LogP | 0.73 at 22℃ and pH3 |
| CAS DataBase Reference | 99189-60-3(CAS DataBase Reference) |
Safety Information
| Hazard Codes | T |
| Risk Statements | 61 |
| Safety Statements | 22-24/25-45-53 |
| WGK Germany | 3 |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |
