| Boiling point |
76-79 °C(Press: 10 Torr) |
| Density |
1,11 g/cm3 |
| refractive index |
1.3840-1.3880 |
| Flash point |
78°C |
| Water Solubility |
Decomposes in contact with water,Insoluble in water |
| form |
clear liquid |
| pka |
11.56±0.70(Predicted) |
| color |
Colorless to Light yellow |
| Specific Gravity |
1.11 |
| Hydrolytic Sensitivity |
7: reacts slowly with moisture/water |
| InChIKey |
ITRFWRDOAWGZFV-UHFFFAOYSA-N |
| SMILES |
[Si](N[Si](CCC(F)(F)F)(C)C)(CCC(F)(F)F)(C)C |
| EPA Substance Registry System |
Silanamine, N-[dimethyl(3,3,3-trifluoropropyl)silyl]-1,1-dimethyl-1-(3,3,3-trifluoropropyl)- (39482-87-6) |
