2,3-Pyridinedicarboxylic anhydride
- Product Name2,3-Pyridinedicarboxylic anhydride
- CAS699-98-9
- MFC7H3NO3
- MW149.1
- EINECS211-834-1
- MOL File699-98-9.mol
Chemical Properties
| Melting point | 137-139 °C (lit.) |
| Boiling point | 270.14°C (rough estimate) |
| Density | 1.4974 (rough estimate) |
| refractive index | 1.4835 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | -2.24±0.20(Predicted) |
| form | powder to crystal |
| color | White to Orange to Green |
| Water Solubility | Optimal solubility in water. |
| Sensitive | Moisture Sensitive |
| BRN | 125111 |
| InChI | InChI=1S/C7H3NO3/c9-6-4-2-1-3-8-5(4)7(10)11-6/h1-3H |
| InChIKey | MCQOWYALZVKMAR-UHFFFAOYSA-N |
| SMILES | C12C(=O)OC(=O)C1=CC=CN=2 |
| CAS DataBase Reference | 699-98-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,3-Pyridinedicarboxylic anhydride(699-98-9) |
| EPA Substance Registry System | Furo[3,4-b]pyridine-5,7-dione (699-98-9) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | TSCA listed |
| HS Code | 29333990 |
