5-O-Methylnaringenin
- Product Name5-O-Methylnaringenin
- CAS61775-19-7
- MFC16H14O5
- MW286.28
- EINECS200-258-5
- MOL File61775-19-7.mol
Chemical Properties
| Melting point | 231-232 °C |
| Boiling point | 555.9±50.0 °C(Predicted) |
| Density | 1.370±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| pka | 7.35±0.40(Predicted) |
| color | White to off-white |
| Major Application | metabolomics vitamins, nutraceuticals, and natural products |
| InChI | 1S/C16H14O5/c1-20-14-6-11(18)7-15-16(14)12(19)8-13(21-15)9-2-4-10(17)5-3-9/h2-7,13,17-18H,8H2,1H3/t13-/m0/s1 |
| InChIKey | CWZLMWSCLBFCBY-ZDUSSCGKSA-N |
| SMILES | COc1cc(O)cc2O[C@@H](CC(=O)c12)c3ccc(O)cc3 |
Safety Information
| Hazard Codes | N |
| Risk Statements | 50 |
| Safety Statements | 61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 |
