| Melting point |
115 °C |
| Boiling point |
213-214 °C(lit.) |
| Density |
0.874 g/mL at 25 °C(lit.) |
| refractive index |
n20/D 1.502(lit.) |
| Flash point |
185 °F |
| storage temp. |
Inert atmosphere,Room Temperature |
| form |
clear liquid |
| color |
Colorless to Light yellow |
| Specific Gravity |
0.872 |
| Hydrolytic Sensitivity |
3: reacts with aqueous base |
| BRN |
1072658 |
| InChI |
InChI=1S/C10H18Si2/c1-11(2)9-5-7-10(8-6-9)12(3)4/h5-8,11-12H,1-4H3 |
| InChIKey |
KQERVIARWMHFOS-UHFFFAOYSA-N |
| SMILES |
C1([SiH](C)C)=CC=C([SiH](C)C)C=C1 |
| CAS DataBase Reference |
2488-01-9(CAS DataBase Reference) |
| NIST Chemistry Reference |
1,4-Bis(dimethylsilyl)benzene(2488-01-9) |
| EPA Substance Registry System |
Silane, 1,4-phenylenebis[dimethyl- (2488-01-9) |
