3-Pyridinol N-oxide
- Product Name3-Pyridinol N-oxide
- CAS6602-28-4
- MFC5H5NO2
- MW111.1
- EINECS229-545-4
- MOL File6602-28-4.mol
Chemical Properties
| Melting point | 190-192 °C(lit.) |
| Boiling point | 208.19°C (rough estimate) |
| Density | 1.3113 (rough estimate) |
| refractive index | 1.4260 (estimate) |
| pka | 8.07±0.10(Predicted) |
| form | powder to crystal |
| color | White to Yellow to Orange |
| InChI | InChI=1S/C5H5NO2/c7-5-2-1-3-6(8)4-5/h1-4,7H |
| InChIKey | YMEZKRMAPQIBQH-UHFFFAOYSA-N |
| SMILES | C1[N+]([O-])=CC=CC=1O |
| CAS DataBase Reference | 6602-28-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Pyridinium,1,3-dihydroxy-,1-hydroxide,inner salt(6602-28-4) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38-40 |
| Safety Statements | 26-27-36/37/39-7/8-36-22 |
| WGK Germany | 3 |
| RTECS | UU7719100 |
| HS Code | 29333999 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Carc. 2 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
