4'-Chloro-3'-(trifluoromethyl)acetophenone
- Product Name4'-Chloro-3'-(trifluoromethyl)acetophenone
- CAS129825-11-2
- MFC9H6ClF3O
- MW222.59
- EINECS642-454-8
- MOL File129825-11-2.mol
Chemical Properties
| Melting point | 61-63°C |
| Boiling point | 236.6±35.0 °C(Predicted) |
| Density | 1.337±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Almost white |
| InChI | 1S/C9H6ClF3O/c1-5(14)6-2-3-8(10)7(4-6)9(11,12)13/h2-4H,1H3 |
| InChIKey | UYNMUXTXDHJBEN-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(Cl)c(c1)C(F)(F)F |
| CAS DataBase Reference | 129825-11-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,F,Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | WGK 3 |
| Hazard Note | Flammable/Irritant |
| HazardClass | IRRITANT |
| PackingGroup | I |
| HS Code | 2914790090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |