1-(4-Nitrophenyl)-2-thiourea
- Product Name1-(4-Nitrophenyl)-2-thiourea
- CAS3696-22-8
- MFC7H7N3O2S
- MW197.21
- EINECS223-021-9
- MOL File3696-22-8.mol
Chemical Properties
| Melting point | 206 °C (dec.)(lit.) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | Light yellow to Yellow to Orange |
| BRN | 2806574 |
| InChI | 1S/C7H7N3O2S/c8-7(13)9-5-1-3-6(4-2-5)10(11)12/h1-4H,(H3,8,9,13) |
| InChIKey | BLYAANPIHFKKMQ-UHFFFAOYSA-N |
| SMILES | NC(=S)Nc1ccc(cc1)[N+]([O-])=O |
| CAS DataBase Reference | 3696-22-8(CAS DataBase Reference) |
Safety Information
| Hazard Codes | T |
| Risk Statements | 36/37/38-25 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| HS Code | 2930.90.2900 |
| HazardClass | 6.1 |
| PackingGroup | II |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
