2-Amino-3,4-dimethylbenzoic acid
- Product Name2-Amino-3,4-dimethylbenzoic acid
- CAS50419-58-4
- MFC9H11NO2
- MW165.19
- EINECS610-529-4
- MOL File50419-58-4.mol
Chemical Properties
| Melting point | 180°C (dec.) |
| Boiling point | 340.3±30.0 °C(Predicted) |
| Density | 1+-.0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 5.18±0.10(Predicted) |
| form | powder to crystal |
| color | White to Light yellow |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C9H11NO2/c1-5-3-4-7(9(11)12)8(10)6(5)2/h3-4H,10H2,1-2H3,(H,11,12) |
| InChIKey | MUOBMUYSNYMSDM-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(C)C(C)=C1N |
| CAS DataBase Reference | 50419-58-4(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-37/39-37 |
| Hazard Note | Irritant |
| HS Code | 29224999 |
