4,4'-DIMETHOXY-2,2'-BIPYRIDINE
- Product Name4,4'-DIMETHOXY-2,2'-BIPYRIDINE
- CAS17217-57-1
- MFC12H12N2O2
- MW216.24
- EINECS628-568-0
- MOL File17217-57-1.mol
Chemical Properties
| Melting point | 168-171 °C(lit.) |
| Boiling point | 347.6±37.0℃ (760 Torr) |
| Density | 1.143±0.06 g/cm3 (20 ºC 760 Torr) |
| refractive index | 1.6660 (estimate) |
| Flash point | 127.0±16.8℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 5.69±0.30(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| InChI | InChI=1S/C12H12N2O2/c1-15-9-3-5-13-11(7-9)12-8-10(16-2)4-6-14-12/h3-8H,1-2H3 |
| InChIKey | IMEVSAIFJKKDAP-UHFFFAOYSA-N |
| SMILES | C1(C2=NC=CC(OC)=C2)=NC=CC(OC)=C1 |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |