| Melting point |
98.0 to 102.0 °C |
| Boiling point |
567.0±45.0 °C(Predicted) |
| Density |
1.227±0.06 g/cm3(Predicted) |
| storage temp. |
Sealed in dry,Store in freezer, under -20°C |
| solubility |
DMSO: 34 mg/mL with heating and sonicating, soluble |
| form |
solid |
| pka |
10.03±0.20(Predicted) |
| color |
White to Light yellow |
| λmax |
280nm(EtOH)(lit.) |
| InChI |
InChI=1S/C21H24O6/c1-24-18-7-5-13(11-20(18)26-3)8-15-12-27-21(23)16(15)9-14-4-6-17(22)19(10-14)25-2/h4-7,10-11,15-16,22H,8-9,12H2,1-3H3/t15-,16+/m0/s1 |
| InChIKey |
NQWVSMVXKMHKTF-JKSUJKDBSA-N |
| SMILES |
O1C[C@H](CC2=CC=C(OC)C(OC)=C2)[C@@H](CC2=CC=C(O)C(OC)=C2)C1=O |
| LogP |
2.470 (est) |
| CAS DataBase Reference |
7770-78-7(CAS DataBase Reference) |
