(S)-N-Fmoc-(3-Pyridyl)alanine
- Product Name(S)-N-Fmoc-(3-Pyridyl)alanine
- CAS175453-07-3
- MFC23H20N2O4
- MW388.42
- EINECS
- MOL File175453-07-3.mol
Chemical Properties
| Melting point | 155.3 °C |
| Boiling point | 514.13°C (rough estimate) |
| Density | 1.2692 (rough estimate) |
| refractive index | 1.6300 (estimate) |
| storage temp. | 2-8°C |
| form | Solid |
| pka | 3.32±0.10(Predicted) |
| color | White to off-white |
| optical activity | Consistent with structure |
| BRN | 9154190 |
| Major Application | peptide synthesis |
| InChI | InChI=1/C23H20N2O4/c26-22(27)21(12-15-6-5-11-24-13-15)25-23(28)29-14-20-18-9-3-1-7-16(18)17-8-2-4-10-19(17)20/h1-11,13,20-21H,12,14H2,(H,25,28)(H,26,27)/t21-/s3 |
| InChIKey | JQLPMTXRCLXOJO-DLINEHSKNA-N |
| SMILES | C1(COC(=O)N[C@H](C(=O)O)CC2C=NC=CC=2)C2C=CC=CC=2C2C=CC=CC1=2 |&1:6,r| |
| CAS DataBase Reference | 175453-07-3(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
