Melting point |
184-186 °C(lit.) |
bulk density |
580kg/m3 |
storage temp. |
Sealed in dry,Room Temperature |
solubility |
H2O: 0.1 g/mL, clear |
form |
Crystalline Powder or Crystals With Lumps |
color |
White to beige |
PH |
2.0-2.2 (50g/l, H2O, 20℃) |
Water Solubility |
Soluble in water and alcohol. |
Sensitive |
Light Sensitive |
BRN |
4219768 |
Boiling point |
274-275°C (1013 hPa) |
InChI |
InChI=1S/C10H16N2.H2O4S/c1-3-12(4-2)10-7-5-9(11)6-8-10;1-5(2,3)4/h5-8H,3-4,11H2,1-2H3;(H2,1,2,3,4) |
InChIKey |
AYLDJQABCMPYEN-UHFFFAOYSA-N |
SMILES |
C1(N(CC)CC)=CC=C(N)C=C1.S(O)(O)(=O)=O |
CAS DataBase Reference |
6283-63-2(CAS DataBase Reference) |