3-hydroxy-1-methyl-5-pyridin-3-yl-pyrrolidin-2-one
- Product Name3-hydroxy-1-methyl-5-pyridin-3-yl-pyrrolidin-2-one
- CAS34834-67-8
- MFC10H12N2O2
- MW192.21
- EINECS
- MOL File34834-67-8.mol
Chemical Properties
| Melting point | 107-109°C |
| Boiling point | 416.5±45.0 °C(Predicted) |
| Density | 1.275±0.06 g/cm3(Predicted) |
| Flash point | 9℃ |
| storage temp. | Hygroscopic, -20°C Freezer, Under Inert Atmosphere |
| solubility | DMF: 30 mg/ml; DMSO: 30 mg/ml; Ethanol: 30 mg/ml; PBS (pH 7.2): 10 mg/ml |
| form | A crystalline solid |
| pka | 13.02±0.40(Predicted) |
| color | White to off-white |
| Major Application | cell analysis clinical research general analytical life science and biopharma metabolomics |
| InChI | InChI=1S/C10H12N2O2/c1-12-8(5-9(13)10(12)14)7-3-2-4-11-6-7/h2-4,6,8-9,13H,5H2,1H3/t8-,9+/m0/s1 |
| InChIKey | XOKCJXZZNAUIQN-DTWKUNHWSA-N |
| SMILES | CN1[C@@H](C[C@@H](O)C1=O)C=2C=CC=NC2 |
Safety Information
| Hazard Codes | F,T |
| Risk Statements | 11-23/24/25-39/23/24/25 |
| Safety Statements | 16-36/37-45 |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
| WGK Germany | 1 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
