1,4-Bis(hydroxydimethylsilyl)benzene
- Product Name1,4-Bis(hydroxydimethylsilyl)benzene
- CAS2754-32-7
- MFC10H18O2Si2
- MW226.42
- EINECS220-405-8
- MOL File2754-32-7.mol
Chemical Properties
| Melting point | 133-136 °C(lit.) |
| Boiling point | 289.6±36.0 °C(Predicted) |
| Density | 1.02±0.1 g/cm3(Predicted) |
| Flash point | >110°C |
| storage temp. | 2-8°C |
| pka | 13.91±0.53(Predicted) |
| Appearance | White to off-white Solid |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| InChI | InChI=1S/C10H18O2Si2/c1-13(2,11)9-5-7-10(8-6-9)14(3,4)12/h5-8,11-12H,1-4H3 |
| InChIKey | YBNBOGKRCOCJHH-UHFFFAOYSA-N |
| SMILES | C1([Si](C)(C)O)=CC=C([Si](C)(C)O)C=C1 |
| CAS DataBase Reference | 2754-32-7(CAS DataBase Reference) |
| EPA Substance Registry System | Silanol, 1,4-phenylenebis[dimethyl- (2754-32-7) |
Safety Information
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2931900090 |
