Pentafluorophenylhydrazine
- Product NamePentafluorophenylhydrazine
- CAS828-73-9
- MFC6H3F5N2
- MW198.09
- EINECS212-586-7
- MOL File828-73-9.mol
Chemical Properties
| Melting point | 74-76 °C(lit.) |
| Boiling point | 117.6±40.0 °C(Predicted) |
| Density | 1.4980 (estimate) |
| storage temp. | -20°C |
| solubility | Soluble in methanol. |
| pka | 4.05±0.40(Predicted) |
| form | powder to crystal |
| color | White to Brown |
| Sensitive | Air Sensitive |
| BRN | 747800 |
| InChI | InChI=1S/C6H3F5N2/c7-1-2(8)4(10)6(13-12)5(11)3(1)9/h13H,12H2 |
| InChIKey | BYCUWCJUPSUFBX-UHFFFAOYSA-N |
| SMILES | N(C1=C(F)C(F)=C(F)C(F)=C1F)N |
| CAS DataBase Reference | 828-73-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | MV8325000 |
| HazardClass | IRRITANT |
| HS Code | 29280000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |