6-Heptenoic acid
- Product Name6-Heptenoic acid
- CAS1119-60-4
- MFC7H12O2
- MW128.17
- EINECS214-283-5
- MOL File1119-60-4.mol
Chemical Properties
| Melting point | -6.5 °C (lit.) |
| Boiling point | 222-224 °C (lit.) |
| Density | 0.946 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | 2-8°C |
| form | liquid |
| pka | 4.75±0.10(Predicted) |
| color | Colourless to light yellow |
| Water Solubility | Miscible with water. |
| BRN | 1747265 |
| InChI | InChI=1S/C7H12O2/c1-2-3-4-5-6-7(8)9/h2H,1,3-6H2,(H,8,9) |
| InChIKey | RWNJOXUVHRXHSD-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CCCCC=C |
| LogP | 1.930 (est) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 3 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 2916199590 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
