
6-Heptenoic acid
- Product Name6-Heptenoic acid
- CAS1119-60-4
- MFC7H12O2
- MW128.17
- EINECS214-283-5
- MOL File1119-60-4.mol
Chemical Properties
Melting point | -6.5 °C (lit.) |
Boiling point | 222-224 °C (lit.) |
Density | 0.946 g/mL at 25 °C (lit.) |
refractive index | n |
Flash point | >230 °F |
storage temp. | 2-8°C |
form | liquid |
pka | 4.75±0.10(Predicted) |
color | Colourless to light yellow |
Water Solubility | Miscible with water. |
BRN | 1747265 |
InChI | InChI=1S/C7H12O2/c1-2-3-4-5-6-7(8)9/h2H,1,3-6H2,(H,8,9) |
InChIKey | RWNJOXUVHRXHSD-UHFFFAOYSA-N |
SMILES | C(O)(=O)CCCCC=C |
LogP | 1.930 (est) |
Safety Information
Hazard Codes | C |
Risk Statements | 34 |
Safety Statements | 26-36/37/39-45 |
RIDADR | UN 3265 8/PG 3 |
WGK Germany | 3 |
HazardClass | 8 |
PackingGroup | II |
HS Code | 2916199590 |