BENZYL AZIDE
- Product NameBENZYL AZIDE
- CAS622-79-7
- MFC7H7N3
- MW133.15
- EINECS210-752-3
- MOL File622-79-7.mol
Chemical Properties
| Melting point | 157℃ |
| Boiling point | 81-83°C 16mm |
| Density | 1.0655 |
| refractive index | 1.5341 |
| RTECS | XS6650000 |
| Flash point | 82-85°C/16mm |
| storage temp. | 2-8°C |
| form | Liquid |
| Specific Gravity | 1.0655 |
| Appearance | Colorless to light yellow Liquid |
| Water Solubility | Insoluble in waterMiscible with ethanol and diethyl ether. Immiscible with water. |
| BRN | 636825 |
| InChI | InChI=1S/C7H7N3/c8-10-9-6-7-4-2-1-3-5-7/h1-5H,6H2 |
| InChIKey | UDLLFLQFQMACJB-UHFFFAOYSA-N |
| SMILES | C1(CN=[N+]=[N-])=CC=CC=C1 |
| CAS DataBase Reference | 622-79-7(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 2-11-48/20/21/22-40 |
| Safety Statements | 15-17-33-36/37 |
| RIDADR | 1993 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29299090 |
| Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects |
| Hazard Classifications | Carc. 2 Eye Irrit. 2 Skin Irrit. 2 STOT RE 2 STOT SE 3 |
