1,1-Diphenylacetone
- Product Name1,1-Diphenylacetone
- CAS781-35-1
- MFC15H14O
- MW210.27
- EINECS212-307-9
- MOL File781-35-1.mol
Chemical Properties
| Melting point | 59-63 °C (lit.) |
| Boiling point | 135 °C (1.5 mmHg) |
| Density | 1.0232 (rough estimate) |
| refractive index | 1.5361 (estimate) |
| storage temp. | 2-8°C |
| form | powder to crystal |
| color | White to Almost white |
| BRN | 1910206 |
| Stability | Stable. Incompatible with strong oxidizing agents. Combustible. |
| InChI | InChI=1S/C15H14O/c1-12(16)15(13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-11,15H,1H3 |
| InChIKey | DBNWBEGCONIRGQ-UHFFFAOYSA-N |
| SMILES | C(C1=CC=CC=C1)(C1=CC=CC=C1)C(=O)C |
| CAS DataBase Reference | 781-35-1(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Propanone, 1,1-diphenyl- (781-35-1) |
Safety Information
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| RTECS | UC2010020 |
| TSCA | TSCA listed |
| HS Code | 29143990 |
| Storage Class | 11 - Combustible Solids |
