| Melting point |
59-63 °C (lit.) |
| Boiling point |
135 °C (1.5 mmHg) |
| Density |
1.0232 (rough estimate) |
| refractive index |
1.5361 (estimate) |
| storage temp. |
2-8°C |
| form |
powder to crystal |
| color |
White to Almost white |
| BRN |
1910206 |
| Stability |
Stable. Incompatible with strong oxidizing agents. Combustible. |
| InChI |
InChI=1S/C15H14O/c1-12(16)15(13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-11,15H,1H3 |
| InChIKey |
DBNWBEGCONIRGQ-UHFFFAOYSA-N |
| SMILES |
C(C1=CC=CC=C1)(C1=CC=CC=C1)C(=O)C |
| CAS DataBase Reference |
781-35-1(CAS DataBase Reference) |
| EPA Substance Registry System |
2-Propanone, 1,1-diphenyl- (781-35-1) |
